CAS 1432681-18-9 appears in our catalog under these names: 1,4-Dimethyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-amine, 95%, 1,4-Dimethyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-8-amine (CAS 1432681-18-9) is a chemical compound with the molecular formula C11H17N3 and a molecular weight of 191.27 g/mol. IUPAC name: 1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-8-amine. InChIKey: LIDJRDIFECEBQM-UHFFFAOYSA-N.
| Molecular formula | C11H17N3 |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-8-amine |
| InChIKey | LIDJRDIFECEBQM-UHFFFAOYSA-N |
| SMILES | CN1CCN(C2=C(C1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)