Products 1432681-61-2
CAS 1432681-61-2 is the registry number for N-{8-Azabicyclo(3.2.1)octan-3-yl}-N-methylbenzamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(8-azabicyclo[3.2.1]octan-3-yl)-N-methylbenzamide;hydrochloride (CAS 1432681-61-2) is a chemical compound with the molecular formula C15H21ClN2O and a molecular weight of 280.79 g/mol. IUPAC name: N-(8-azabicyclo[3.2.1]octan-3-yl)-N-methylbenzamide;hydrochloride. InChIKey: RLGJRBICBSKFPS-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O |
|---|---|
| Molecular weight | 280.79 g/mol |
| IUPAC name | N-(8-azabicyclo[3.2.1]octan-3-yl)-N-methylbenzamide;hydrochloride |
| InChIKey | RLGJRBICBSKFPS-UHFFFAOYSA-N |
| SMILES | CN(C1CC2CCC(C1)N2)C(=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)