CAS 1432682-04-6 appears in our catalog under these names: Ondansetron Impurity 5, 6-Methyl-2,3,4,9-tetrahydro-1H-carbazol-3-one, 95%, 6-Methyl-2,3,4,9-tetrahydro-1H-carbazol-3-one. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 5g, 0,5g, 50mg.
6-methyl-1,2,4,9-tetrahydrocarbazol-3-one (CAS 1432682-04-6) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 6-methyl-1,2,4,9-tetrahydrocarbazol-3-one. InChIKey: CPHXFGFDYFXNFQ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 6-methyl-1,2,4,9-tetrahydrocarbazol-3-one |
| InChIKey | CPHXFGFDYFXNFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CC(=O)CC3 |
Computed by PubChem (NCBI)