Products 1432754-41-0

CAS 1432754-41-0 is the registry number for 6-(Pyridin-3-ylamino)pyridine-2-carboxylic acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-(pyridin-3-ylamino)pyridine-2-carboxylic acid;dihydrochloride (CAS 1432754-41-0) is a chemical compound with the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. IUPAC name: 6-(pyridin-3-ylamino)pyridine-2-carboxylic acid;dihydrochloride. InChIKey: ROVKYSLUEXGQRF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11Cl2N3O2
Molecular weight288.13 g/mol
IUPAC name6-(pyridin-3-ylamino)pyridine-2-carboxylic acid;dihydrochloride
InChIKeyROVKYSLUEXGQRF-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1)NC2=CN=CC=C2)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)