CAS 752151-24-9 appears in our catalog under these names: Anagrelide Impurity 22, Anagrelide Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2-amino-5,6-dichloro-4H-quinazolin-3-yl)acetate (CAS 752151-24-9) is a chemical compound with the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. IUPAC name: methyl 2-(2-amino-5,6-dichloro-4H-quinazolin-3-yl)acetate. InChIKey: GPQHPFJCLXKFHS-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3O2 |
|---|---|
| Molecular weight | 288.13 g/mol |
| IUPAC name | methyl 2-(2-amino-5,6-dichloro-4H-quinazolin-3-yl)acetate |
| InChIKey | GPQHPFJCLXKFHS-UHFFFAOYSA-N |
| SMILES | COC(=O)CN1CC2=C(C=CC(=C2Cl)Cl)N=C1N |
Computed by PubChem (NCBI)