Products 143317-90-2
CAS 143317-90-2 appears in our catalog under these names: Piperidine-d11, 98 atom % D, min 98% Chemical Purity, Piperidine–d11, PIPERIDINE-D11, 98 ATOM % D. Offered by: CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 1g.
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine (CAS 143317-90-2) is a chemical compound with the molecular formula C5H11N and a molecular weight of 96.21 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine. InChIKey: NQRYJNQNLNOLGT-KTIYLIMOSA-N.
| Molecular formula | C5H11N |
|---|---|
| Molecular weight | 96.21 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine |
| InChIKey | NQRYJNQNLNOLGT-KTIYLIMOSA-N |
| SMILES | [2H]C1(C(C(N(C(C1([2H])[2H])([2H])[2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)