CAS 45393-79-1 appears in our catalog under these names: Piperidine-d10, Piperidine–d10. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 20mg.
2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine (CAS 45393-79-1) is a chemical compound with the molecular formula C5H11N and a molecular weight of 95.21 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine. InChIKey: NQRYJNQNLNOLGT-YXALHFAPSA-N.
| Molecular formula | C5H11N |
|---|---|
| Molecular weight | 95.21 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidine |
| InChIKey | NQRYJNQNLNOLGT-YXALHFAPSA-N |
| SMILES | [2H]C1(C(C(NC(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)