Products 1433194-62-7
CAS 1433194-62-7 appears in our catalog under these names: 2,7-Di(tert-butyloxycarbonyl)-2,7-diazaspiro[4.4]nonane, 90%, Di-tert-butyl 2,7-diazaspiro(4.4)nonane-2,7-dicarboxylate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ditert-butyl 2,7-diazaspiro[4.4]nonane-2,7-dicarboxylate (CAS 1433194-62-7) is a chemical compound with the molecular formula C17H30N2O4 and a molecular weight of 326.4 g/mol. IUPAC name: ditert-butyl 2,7-diazaspiro[4.4]nonane-2,7-dicarboxylate. InChIKey: KLDVWTLOJCCOFZ-UHFFFAOYSA-N.
| Molecular formula | C17H30N2O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | ditert-butyl 2,7-diazaspiro[4.4]nonane-2,7-dicarboxylate |
| InChIKey | KLDVWTLOJCCOFZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)