CAS 344940-44-9 is the registry number for N-Boc-endo-3-N-Boc-Aminotropane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 344940-44-9) is a chemical compound with the molecular formula C17H30N2O4 and a molecular weight of 326.4 g/mol. IUPAC name: tert-butyl (1R,5S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: TVQSUOLHHNWGEY-YHWZYXNKSA-N.
| Molecular formula | C17H30N2O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | tert-butyl (1R,5S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | TVQSUOLHHNWGEY-YHWZYXNKSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C[C@H]2CC[C@@H](C1)N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)