CAS 14335-29-6 is the registry number for Glycyl diphenylborinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Diphenylboranyl 2-aminoacetate (CAS 14335-29-6) is a chemical compound with the molecular formula C14H14BNO2 and a molecular weight of 239.08 g/mol. IUPAC name: diphenylboranyl 2-aminoacetate. InChIKey: IVHLNYVPKWICDY-UHFFFAOYSA-N.
| Molecular formula | C14H14BNO2 |
|---|---|
| Molecular weight | 239.08 g/mol |
| IUPAC name | diphenylboranyl 2-aminoacetate |
| InChIKey | IVHLNYVPKWICDY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1)(C2=CC=CC=C2)OC(=O)CN |
Computed by PubChem (NCBI)