Products 14335-29-6

CAS 14335-29-6 is the registry number for Glycyl diphenylborinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Diphenylboranyl 2-aminoacetate (CAS 14335-29-6) is a chemical compound with the molecular formula C14H14BNO2 and a molecular weight of 239.08 g/mol. IUPAC name: diphenylboranyl 2-aminoacetate. InChIKey: IVHLNYVPKWICDY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14BNO2
Molecular weight239.08 g/mol
IUPAC namediphenylboranyl 2-aminoacetate
InChIKeyIVHLNYVPKWICDY-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1)(C2=CC=CC=C2)OC(=O)CN

Computed by PubChem (NCBI)