Products 669072-93-9

CAS 669072-93-9 appears in our catalog under these names: 9–Ethylcarbazole–3–boronic Acid (contains varying amounts of Anhydride), 9-Ethylcarbazole-3-boronic Acid (contains varying amounts of Anhydride), (9-Ethyl-9H-carbazol-3-yl)boronic acid 98%, (9-ethyl-9H-carbazol-3-yl)boronic acid, 98%, 98%, (9-Ethyl-9H-carbazol-3-yl)boronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

(9-ethylcarbazol-3-yl)boronic acid (CAS 669072-93-9) is a chemical compound with the molecular formula C14H14BNO2 and a molecular weight of 239.08 g/mol. IUPAC name: (9-ethylcarbazol-3-yl)boronic acid. InChIKey: JUBKLYCRFZTXBA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14BNO2
Molecular weight239.08 g/mol
IUPAC name(9-ethylcarbazol-3-yl)boronic acid
InChIKeyJUBKLYCRFZTXBA-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)N(C3=CC=CC=C32)CC)(O)O

Computed by PubChem (NCBI)