CAS 1433849-53-6 is the registry number for tert-Butyl (3s)-3-methyl-4-(6-nitropyridin-3-yl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl (3S)-3-methyl-4-(6-nitro-3-pyridinyl)piperazine-1-carboxylate (CAS 1433849-53-6) is a chemical compound with the molecular formula C15H22N4O4 and a molecular weight of 322.36 g/mol. IUPAC name: tert-butyl (3S)-3-methyl-4-(6-nitro-3-pyridinyl)piperazine-1-carboxylate. InChIKey: JJXVPQLHSUHZBA-NSHDSACASA-N.
| Molecular formula | C15H22N4O4 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | tert-butyl (3S)-3-methyl-4-(6-nitro-3-pyridinyl)piperazine-1-carboxylate |
| InChIKey | JJXVPQLHSUHZBA-NSHDSACASA-N |
| SMILES | C[C@H]1CN(CCN1C2=CN=C(C=C2)[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)