Products 2348-19-8

CAS 2348-19-8 is the registry number for Nonanal-2,4-dinitrophenylhydrazone 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

2,4-dinitro-N-[(E)-nonylideneamino]aniline (CAS 2348-19-8) is a chemical compound with the molecular formula C15H22N4O4 and a molecular weight of 322.36 g/mol. IUPAC name: 2,4-dinitro-N-[(E)-nonylideneamino]aniline. InChIKey: STBNOHBRCCXRIK-LFIBNONCSA-N.

Identity
Molecular formulaC15H22N4O4
Molecular weight322.36 g/mol
IUPAC name2,4-dinitro-N-[(E)-nonylideneamino]aniline
InChIKeySTBNOHBRCCXRIK-LFIBNONCSA-N
SMILESCCCCCCCC/C=N/NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-]

Computed by PubChem (NCBI)