CAS 2348-19-8 is the registry number for Nonanal-2,4-dinitrophenylhydrazone 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,4-dinitro-N-[(E)-nonylideneamino]aniline (CAS 2348-19-8) is a chemical compound with the molecular formula C15H22N4O4 and a molecular weight of 322.36 g/mol. IUPAC name: 2,4-dinitro-N-[(E)-nonylideneamino]aniline. InChIKey: STBNOHBRCCXRIK-LFIBNONCSA-N.
| Molecular formula | C15H22N4O4 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | 2,4-dinitro-N-[(E)-nonylideneamino]aniline |
| InChIKey | STBNOHBRCCXRIK-LFIBNONCSA-N |
| SMILES | CCCCCCCC/C=N/NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)