Products 1433946-54-3
CAS 1433946-54-3 is the registry number for 4-(4-Bromophenyl)-2-((2S,4S)-4-methylpyrrolidin-2-yl)-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-bromophenyl)-2-[(2S,4S)-4-methylpyrrolidin-2-yl]-1H-imidazole (CAS 1433946-54-3) is a chemical compound with the molecular formula C14H16BrN3 and a molecular weight of 306.20 g/mol. IUPAC name: 5-(4-bromophenyl)-2-[(2S,4S)-4-methylpyrrolidin-2-yl]-1H-imidazole. InChIKey: ZCOPWHOTJYATSA-CABZTGNLSA-N.
| Molecular formula | C14H16BrN3 |
|---|---|
| Molecular weight | 306.20 g/mol |
| IUPAC name | 5-(4-bromophenyl)-2-[(2S,4S)-4-methylpyrrolidin-2-yl]-1H-imidazole |
| InChIKey | ZCOPWHOTJYATSA-CABZTGNLSA-N |
| SMILES | C[C@H]1C[C@H](NC1)C2=NC=C(N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)