CAS 2886034-05-3 appears in our catalog under these names: 3-(cis-1-(3-Bromophenyl)-3-methylcyclobutyl)-4-methyl-4H-1,2,4-triazole, 95%, 3-(cis-1-(3-Bromophenyl)-3-methylcyclobutyl)-4-methyl-4H-1,2,4-triazole, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-[1-(3-bromophenyl)-3-methylcyclobutyl]-4-methyl-1,2,4-triazole (CAS 2886034-05-3) is a chemical compound with the molecular formula C14H16BrN3 and a molecular weight of 306.20 g/mol. IUPAC name: 3-[1-(3-bromophenyl)-3-methylcyclobutyl]-4-methyl-1,2,4-triazole. InChIKey: BSLTUFDMPHKQTJ-UHFFFAOYSA-N.
| Molecular formula | C14H16BrN3 |
|---|---|
| Molecular weight | 306.20 g/mol |
| IUPAC name | 3-[1-(3-bromophenyl)-3-methylcyclobutyl]-4-methyl-1,2,4-triazole |
| InChIKey | BSLTUFDMPHKQTJ-UHFFFAOYSA-N |
| SMILES | CC1CC(C1)(C2=CC(=CC=C2)Br)C3=NN=CN3C |
Computed by PubChem (NCBI)