CAS 1433965-43-5 is the registry number for 2-Bromo-N,N-dimethylnicotinamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-N,N-dimethylpyridine-3-carboxamide (CAS 1433965-43-5) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 2-bromo-N,N-dimethylpyridine-3-carboxamide. InChIKey: XLLFOYLOXZNGKU-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-bromo-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | XLLFOYLOXZNGKU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(N=CC=C1)Br |
Computed by PubChem (NCBI)