CAS 1434126-90-5 appears in our catalog under these names: (R)-Methyl 3-methylmorpholine-3-carboxylate hydrochloride, 97%, (R)-Methyl 3-methylmorpholine-3-carboxylate hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl (3R)-3-methylmorpholine-3-carboxylate;hydrochloride (CAS 1434126-90-5) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: methyl (3R)-3-methylmorpholine-3-carboxylate;hydrochloride. InChIKey: RTMAITBZHRHRPU-OGFXRTJISA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | methyl (3R)-3-methylmorpholine-3-carboxylate;hydrochloride |
| InChIKey | RTMAITBZHRHRPU-OGFXRTJISA-N |
| SMILES | C[C@@]1(COCCN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)