CAS 1434141-87-3 appears in our catalog under these names: 2-Bromo-5-(4-methoxybenzyl)-5h-pyrrolo[2,3-b]pyrazine, 95%, 2-Bromo-5-(4-methoxybenzyl)-5H-pyrrolo(2,3-b)pyrazine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
2-bromo-5-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyrazine (CAS 1434141-87-3) is a chemical compound with the molecular formula C14H12BrN3O and a molecular weight of 318.17 g/mol. IUPAC name: 2-bromo-5-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyrazine. InChIKey: DFDZCGFENWVVHO-UHFFFAOYSA-N.
| Molecular formula | C14H12BrN3O |
|---|---|
| Molecular weight | 318.17 g/mol |
| IUPAC name | 2-bromo-5-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyrazine |
| InChIKey | DFDZCGFENWVVHO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C=CC3=NC(=CN=C32)Br |
Computed by PubChem (NCBI)