CAS 394668-43-0 appears in our catalog under these names: EBV lytic cycle inducer-1/ 100%, EBV lytic cycle inducer–1, EBV lytic cycle inducer-1, 98%, 98%, EBV lytic cycle inducer-1, 98.27%, EBV lytic cycle inducer-1, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
3-bromo-N-[(E)-1-pyridin-2-ylethylideneamino]benzamide (CAS 394668-43-0) is a chemical compound with the molecular formula C14H12BrN3O and a molecular weight of 318.17 g/mol. IUPAC name: 3-bromo-N-[(E)-1-pyridin-2-ylethylideneamino]benzamide. InChIKey: GZJPBATWGXWPLE-LICLKQGHSA-N.
| Molecular formula | C14H12BrN3O |
|---|---|
| Molecular weight | 318.17 g/mol |
| IUPAC name | 3-bromo-N-[(E)-1-pyridin-2-ylethylideneamino]benzamide |
| InChIKey | GZJPBATWGXWPLE-LICLKQGHSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC(=CC=C1)Br)/C2=CC=CC=N2 |
Computed by PubChem (NCBI)