CAS 143426-55-5 is the registry number for 2-(4-(1H-Pyrazol-1-yl)phenyl)acetonitrile. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(4-pyrazol-1-ylphenyl)acetonitrile (CAS 143426-55-5) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 2-(4-pyrazol-1-ylphenyl)acetonitrile. InChIKey: QGSWQGPKRSYWGS-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 2-(4-pyrazol-1-ylphenyl)acetonitrile |
| InChIKey | QGSWQGPKRSYWGS-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)CC#N |
Computed by PubChem (NCBI)