CAS 143485-62-5 appears in our catalog under these names: Gly-ala-gly-oh hydrochloride, 95%, GLy-ala-gly-oh hcl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]acetic acid;hydrochloride (CAS 143485-62-5) is a chemical compound with the molecular formula C7H14ClN3O4 and a molecular weight of 239.66 g/mol. IUPAC name: 2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]acetic acid;hydrochloride. InChIKey: MGWZHGPYGDWUMX-WCCKRBBISA-N.
| Molecular formula | C7H14ClN3O4 |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 2-[[(2S)-2-[(2-aminoacetyl)amino]propanoyl]amino]acetic acid;hydrochloride |
| InChIKey | MGWZHGPYGDWUMX-WCCKRBBISA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)O)NC(=O)CN.Cl |
Computed by PubChem (NCBI)