CAS 63934-26-9 is the registry number for N-(N-glycylglycyl)-L-Alanine monohydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoic acid;hydrochloride (CAS 63934-26-9) is a chemical compound with the molecular formula C7H14ClN3O4 and a molecular weight of 239.66 g/mol. IUPAC name: (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoic acid;hydrochloride. InChIKey: UCYJYTCNHXGMGP-WCCKRBBISA-N.
| Molecular formula | C7H14ClN3O4 |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoic acid;hydrochloride |
| InChIKey | UCYJYTCNHXGMGP-WCCKRBBISA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)CNC(=O)CN.Cl |
Computed by PubChem (NCBI)