Products 1434905-61-9

CAS 1434905-61-9 is the registry number for tert-Butyl 2,6-dioxo-9-azabicyclo(3.3.1)nonane-9-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-dioxo-9-azabicyclo[3.3.1]nonane-9-carboxylate (CAS 1434905-61-9) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: tert-butyl 2,6-dioxo-9-azabicyclo[3.3.1]nonane-9-carboxylate. InChIKey: BFERYOPSUVHNPN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO4
Molecular weight253.29 g/mol
IUPAC nametert-butyl 2,6-dioxo-9-azabicyclo[3.3.1]nonane-9-carboxylate
InChIKeyBFERYOPSUVHNPN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2CCC(=O)C1CCC2=O

Computed by PubChem (NCBI)