CAS 1435-55-8 appears in our catalog under these names: Dihydro-Quinidine, (+)-Dihydroquinidine, >95% (HPLC), Hydroquinidine/ 98.9% (existing batch purity), Dihydroquinidine, Hydroquinidine, >98.0%(HPLC)(T). Offered by: Chemat Brand, TRC, TargetMol, Biosynth, TCI. Available pack sizes: on request, 100mg, 1g, 500mg, 50g, 5g, 25g, 10g.
(S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CAS 1435-55-8) is a chemical compound with the molecular formula C20H26N2O2 and a molecular weight of 326.4 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol. InChIKey: LJOQGZACKSYWCH-LHHVKLHASA-N.
| Molecular formula | C20H26N2O2 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChIKey | LJOQGZACKSYWCH-LHHVKLHASA-N |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=C4C=C(C=CC4=NC=C3)OC)O |
Computed by PubChem (NCBI)