Products 98123-83-2

CAS 98123-83-2 is the registry number for Epsiprantel. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10 mg, 1 mg, 50 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

2-(cyclohexanecarbonyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one (CAS 98123-83-2) is a chemical compound with the molecular formula C20H26N2O2 and a molecular weight of 326.4 g/mol. IUPAC name: 2-(cyclohexanecarbonyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one. InChIKey: LGUDKOQUWIHXOV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H26N2O2
Molecular weight326.4 g/mol
IUPAC name2-(cyclohexanecarbonyl)-1,3,6,7,8,12b-hexahydropyrazino[2,1-a][2]benzazepin-4-one
InChIKeyLGUDKOQUWIHXOV-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(=O)N2CC3C4=CC=CC=C4CCCN3C(=O)C2

Computed by PubChem (NCBI)