CAS 143603-57-0 appears in our catalog under these names: Benzothiophenylcyclohexylpiperidine Fumarate, Benzothiophenylcyclohexylpiperidine Fumarate (1.0 mg/mL in Methanol). Offered by: TRC. Available pack sizes: 1g, 5x1ml.
1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine;(E)-but-2-enedioic acid (CAS 143603-57-0) is a chemical compound with the molecular formula C23H29NO4S and a molecular weight of 415.5 g/mol. IUPAC name: 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine;(E)-but-2-enedioic acid. InChIKey: AMTYJSWZECGJOO-WLHGVMLRSA-N.
| Molecular formula | C23H29NO4S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine;(E)-but-2-enedioic acid |
| InChIKey | AMTYJSWZECGJOO-WLHGVMLRSA-N |
| SMILES | C1CCC(CC1)(C2=CC3=CC=CC=C3S2)N4CCCCC4.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)