CAS 2580245-74-3 is the registry number for (2R,3S)-N,N-Bis(4-methoxybenzyl)-3-methylhex-5-yne-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-yne-2-sulfonamide (CAS 2580245-74-3) is a chemical compound with the molecular formula C23H29NO4S and a molecular weight of 415.5 g/mol. IUPAC name: (2R,3S)-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-yne-2-sulfonamide. InChIKey: PNSBWYJBEIKDTD-RBUKOAKNSA-N.
| Molecular formula | C23H29NO4S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | (2R,3S)-N,N-bis[(4-methoxyphenyl)methyl]-3-methylhex-5-yne-2-sulfonamide |
| InChIKey | PNSBWYJBEIKDTD-RBUKOAKNSA-N |
| SMILES | C[C@@H](CC#C)[C@@H](C)S(=O)(=O)N(CC1=CC=C(C=C1)OC)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)