Products 143607-32-3
CAS 143607-32-3 is the registry number for Silver(I) tetrakis(perfluorophenyl)borate, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Silver tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (CAS 143607-32-3) is a chemical compound with the molecular formula C24AgBF20 and a molecular weight of 786.9 g/mol. IUPAC name: silver tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide. InChIKey: YLOLVFHTSXNWDL-UHFFFAOYSA-N.
| Molecular formula | C24AgBF20 |
|---|---|
| Molecular weight | 786.9 g/mol |
| IUPAC name | silver tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| InChIKey | YLOLVFHTSXNWDL-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.[Ag+] |
Computed by PubChem (NCBI)