CAS 143632-57-9 is the registry number for N-Tosyl 4-phenyl piperidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-(4-methylphenyl)sulfonyl-4-phenylpiperidine (CAS 143632-57-9) is a chemical compound with the molecular formula C18H21NO2S and a molecular weight of 315.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-4-phenylpiperidine. InChIKey: WTNVRWQIBJTSDJ-UHFFFAOYSA-N.
| Molecular formula | C18H21NO2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-4-phenylpiperidine |
| InChIKey | WTNVRWQIBJTSDJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)