Products 143632-57-9

CAS 143632-57-9 is the registry number for N-Tosyl 4-phenyl piperidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)sulfonyl-4-phenylpiperidine (CAS 143632-57-9) is a chemical compound with the molecular formula C18H21NO2S and a molecular weight of 315.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-4-phenylpiperidine. InChIKey: WTNVRWQIBJTSDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21NO2S
Molecular weight315.4 g/mol
IUPAC name1-(4-methylphenyl)sulfonyl-4-phenylpiperidine
InChIKeyWTNVRWQIBJTSDJ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)C3=CC=CC=C3

Computed by PubChem (NCBI)