Products 1936219-91-8
CAS 1936219-91-8 appears in our catalog under these names: 3–(Dibenzylamino)–3–methylthietane 1，1–dioxide, 3-(Dibenzylamino)-3-methylthietane 1,1-dioxide, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N-dibenzyl-3-methyl-1,1-dioxothietan-3-amine (CAS 1936219-91-8) is a chemical compound with the molecular formula C18H21NO2S and a molecular weight of 315.4 g/mol. IUPAC name: N,N-dibenzyl-3-methyl-1,1-dioxothietan-3-amine. InChIKey: CDPZOFFVZMYGEU-UHFFFAOYSA-N.
| Molecular formula | C18H21NO2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | N,N-dibenzyl-3-methyl-1,1-dioxothietan-3-amine |
| InChIKey | CDPZOFFVZMYGEU-UHFFFAOYSA-N |
| SMILES | CC1(CS(=O)(=O)C1)N(CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)