Products 143646-48-4

CAS 143646-48-4 is the registry number for tert-Butyl 4,4-diethoxybutylcarbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4,4-diethoxybutyl)carbamate (CAS 143646-48-4) is a chemical compound with the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. IUPAC name: tert-butyl N-(4,4-diethoxybutyl)carbamate. InChIKey: YXAHNXAFHCYWIT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H27NO4
Molecular weight261.36 g/mol
IUPAC nametert-butyl N-(4,4-diethoxybutyl)carbamate
InChIKeyYXAHNXAFHCYWIT-UHFFFAOYSA-N
SMILESCCOC(CCCNC(=O)OC(C)(C)C)OCC

Computed by PubChem (NCBI)