Products 2734265-63-3
CAS 2734265-63-3 is the registry number for 5-C-heptyl-DNJ. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5S)-2-heptyl-2-(hydroxymethyl)piperidine-3,4,5-triol (CAS 2734265-63-3) is a chemical compound with the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. IUPAC name: (2R,3R,4R,5S)-2-heptyl-2-(hydroxymethyl)piperidine-3,4,5-triol. InChIKey: WJOJINIVTKXXQI-QNWHQSFQSA-N.
| Molecular formula | C13H27NO4 |
|---|---|
| Molecular weight | 261.36 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2-heptyl-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | WJOJINIVTKXXQI-QNWHQSFQSA-N |
| SMILES | CCCCCCC[C@]1([C@H]([C@@H]([C@H](CN1)O)O)O)CO |
Computed by PubChem (NCBI)