CAS 14366-74-6 appears in our catalog under these names: [4-(Bromomethyl)benzyl]triphenylphosphonium bromide, 95%, (4-(Bromomethyl)benzyl)triphenylphosphonium bromide, ≥98%, ≥98%, (4-(Bromomethyl)benzyl)triphenylphosphonium bromide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 500g, 25g, 5g.
[4-(bromomethyl)phenyl]methyl-triphenylphosphanium bromide (CAS 14366-74-6) is a chemical compound with the molecular formula C26H23Br2P and a molecular weight of 526.2 g/mol. IUPAC name: [4-(bromomethyl)phenyl]methyl-triphenylphosphanium bromide. InChIKey: KUXBEOGHKWNPTG-UHFFFAOYSA-M.
| Molecular formula | C26H23Br2P |
|---|---|
| Molecular weight | 526.2 g/mol |
| IUPAC name | [4-(bromomethyl)phenyl]methyl-triphenylphosphanium bromide |
| InChIKey | KUXBEOGHKWNPTG-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=C(C=C2)CBr)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)