CAS 67219-44-7 appears in our catalog under these names: 2-(Bromomethyl)benzyltriphenylphosphonium bromide, 95%, {(2-(Bromomethyl)phenyl)methyl}triphenylphosphanium bromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
[2-(bromomethyl)phenyl]methyl-triphenylphosphanium bromide (CAS 67219-44-7) is a chemical compound with the molecular formula C26H23Br2P and a molecular weight of 526.2 g/mol. IUPAC name: [2-(bromomethyl)phenyl]methyl-triphenylphosphanium bromide. InChIKey: NGFRGAZJGZKPQC-UHFFFAOYSA-M.
| Molecular formula | C26H23Br2P |
|---|---|
| Molecular weight | 526.2 g/mol |
| IUPAC name | [2-(bromomethyl)phenyl]methyl-triphenylphosphanium bromide |
| InChIKey | NGFRGAZJGZKPQC-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=CC=C2CBr)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)