Products 143731-19-5

CAS 143731-19-5 is the registry number for 4-Methoxy-2,3,3-trimethyl-4-oxobutanoic Acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methoxy-2,3,3-trimethyl-4-oxobutanoic acid (CAS 143731-19-5) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: 4-methoxy-2,3,3-trimethyl-4-oxobutanoic acid. InChIKey: XSLQBRAKHTYBDD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O4
Molecular weight174.19 g/mol
IUPAC name4-methoxy-2,3,3-trimethyl-4-oxobutanoic acid
InChIKeyXSLQBRAKHTYBDD-UHFFFAOYSA-N
SMILESCC(C(=O)O)C(C)(C)C(=O)OC

Computed by PubChem (NCBI)