Products 1437794-32-5
CAS 1437794-32-5 is the registry number for tert-Butyl N-{4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl}carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamate (CAS 1437794-32-5) is a chemical compound with the molecular formula C15H19N3O5S and a molecular weight of 353.4 g/mol. IUPAC name: tert-butyl N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamate. InChIKey: NKAZRBVLMFSVJU-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O5S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | tert-butyl N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamate |
| InChIKey | NKAZRBVLMFSVJU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)