CAS 96035-23-3 is the registry number for Meropenem Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(4-nitrophenyl)methyl (2R,4R)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate (CAS 96035-23-3) is a chemical compound with the molecular formula C15H19N3O5S and a molecular weight of 353.4 g/mol. IUPAC name: (4-nitrophenyl)methyl (2R,4R)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate. InChIKey: VGLBNJWGUYQZHD-CHWSQXEVSA-N.
| Molecular formula | C15H19N3O5S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (4-nitrophenyl)methyl (2R,4R)-2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate |
| InChIKey | VGLBNJWGUYQZHD-CHWSQXEVSA-N |
| SMILES | CN(C)C(=O)[C@H]1C[C@H](CN1C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])S |
Computed by PubChem (NCBI)