CAS 1438463-77-4 is the registry number for PG3d, 95%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
5-benzyl-4-hydroxy-2-(2-phenylethynyl)-1,3-oxazin-6-one (CAS 1438463-77-4) is a chemical compound with the molecular formula C19H13NO3 and a molecular weight of 303.3 g/mol. IUPAC name: 5-benzyl-4-hydroxy-2-(2-phenylethynyl)-1,3-oxazin-6-one. InChIKey: PVCBFFMVNVSMFO-UHFFFAOYSA-N.
| Molecular formula | C19H13NO3 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 5-benzyl-4-hydroxy-2-(2-phenylethynyl)-1,3-oxazin-6-one |
| InChIKey | PVCBFFMVNVSMFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N=C(OC2=O)C#CC3=CC=CC=C3)O |
Computed by PubChem (NCBI)