CAS 341018-62-0 is the registry number for N-(Dibenzo[b,d]furan-3-yl)-2-hydroxybenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-dibenzofuran-3-yl-2-hydroxybenzamide (CAS 341018-62-0) is a chemical compound with the molecular formula C19H13NO3 and a molecular weight of 303.3 g/mol. IUPAC name: N-dibenzofuran-3-yl-2-hydroxybenzamide. InChIKey: AKBHKTTVVGGLHO-UHFFFAOYSA-N.
| Molecular formula | C19H13NO3 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | N-dibenzofuran-3-yl-2-hydroxybenzamide |
| InChIKey | AKBHKTTVVGGLHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)NC(=O)C4=CC=CC=C4O |
Computed by PubChem (NCBI)