CAS 143899-90-5 is the registry number for Antidepressant agent 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (CAS 143899-90-5) is a chemical compound with the molecular formula C17H24N2 and a molecular weight of 256.4 g/mol. IUPAC name: (1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine. InChIKey: CYPHSPITDGFDMD-PVAVHDDUSA-N.
| Molecular formula | C17H24N2 |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | (1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| InChIKey | CYPHSPITDGFDMD-PVAVHDDUSA-N |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1CC4=C3C=C(C=C4)N |
Computed by PubChem (NCBI)