CAS 936074-67-8 appears in our catalog under these names: 4-(1-Adamantyl)-n1-methylbenzene-1,2-diamine, 95%, 4-(Adamantan-1-yl)-N1-methylbenzene-1,2-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(1-adamantyl)-1-N-methylbenzene-1,2-diamine (CAS 936074-67-8) is a chemical compound with the molecular formula C17H24N2 and a molecular weight of 256.4 g/mol. IUPAC name: 4-(1-adamantyl)-1-N-methylbenzene-1,2-diamine. InChIKey: WCTLXUXMQPNFFM-UHFFFAOYSA-N.
| Molecular formula | C17H24N2 |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 4-(1-adamantyl)-1-N-methylbenzene-1,2-diamine |
| InChIKey | WCTLXUXMQPNFFM-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C23CC4CC(C2)CC(C4)C3)N |
Computed by PubChem (NCBI)