Products 143925-44-4
CAS 143925-44-4 is the registry number for N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide (CAS 143925-44-4) is a chemical compound with the molecular formula C14H9F4NO and a molecular weight of 283.22 g/mol. IUPAC name: N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide. InChIKey: SHPMYWNFAFKATO-UHFFFAOYSA-N.
| Molecular formula | C14H9F4NO |
|---|---|
| Molecular weight | 283.22 g/mol |
| IUPAC name | N-[2-fluoro-5-(trifluoromethyl)phenyl]benzamide |
| InChIKey | SHPMYWNFAFKATO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C(C=CC(=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)