Products 1504465-76-2
CAS 1504465-76-2 appears in our catalog under these names: (2–Amino–5–(trifluoromethyl)phenyl)(2–fluorophenyl)methanone, (2-Amino-5-(trifluoromethyl)phenyl)(2-fluorophenyl)methanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
[2-amino-5-(trifluoromethyl)phenyl]-(2-fluorophenyl)methanone (CAS 1504465-76-2) is a chemical compound with the molecular formula C14H9F4NO and a molecular weight of 283.22 g/mol. IUPAC name: [2-amino-5-(trifluoromethyl)phenyl]-(2-fluorophenyl)methanone. InChIKey: GIITYMKYXCQJJY-UHFFFAOYSA-N.
| Molecular formula | C14H9F4NO |
|---|---|
| Molecular weight | 283.22 g/mol |
| IUPAC name | [2-amino-5-(trifluoromethyl)phenyl]-(2-fluorophenyl)methanone |
| InChIKey | GIITYMKYXCQJJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)C(F)(F)F)N)F |
Computed by PubChem (NCBI)