Products 1439373-55-3

CAS 1439373-55-3 appears in our catalog under these names: (S)-Morpholine-2-carboxylic acid hydrochloride, (S)-Morpholine-2-carboxylic acid hydrochloride 95%, (S)-Morpholine-2-carboxylic acid hydrochloride, 95%, 95%, (S)-Morpholine-2-carboxylic acid hydrochloride, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2S)-morpholine-2-carboxylic acid;hydrochloride (CAS 1439373-55-3) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 167.59 g/mol. IUPAC name: (2S)-morpholine-2-carboxylic acid;hydrochloride. InChIKey: XLKJUXXMBJDEBH-WCCKRBBISA-N.

Identity
Molecular formulaC5H10ClNO3
Molecular weight167.59 g/mol
IUPAC name(2S)-morpholine-2-carboxylic acid;hydrochloride
InChIKeyXLKJUXXMBJDEBH-WCCKRBBISA-N
SMILESC1CO[C@@H](CN1)C(=O)O.Cl

Computed by PubChem (NCBI)