CAS 143966-57-8 is the registry number for N-t-Boc-L-serine Allyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
Prop-2-enyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 143966-57-8) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: prop-2-enyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: UXCJZSOZYIDKFL-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | prop-2-enyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | UXCJZSOZYIDKFL-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)OCC=C |
Computed by PubChem (NCBI)