CAS 143978-86-3 is the registry number for N–{((2–Methyl–2–propanyl)oxy)carbonyl}–3–(methylsulfonyl)–L–valine. Offered by: GLPBio. Available pack sizes: 250mg.
3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylbutanoic acid (CAS 143978-86-3) is a chemical compound with the molecular formula C11H21NO6S and a molecular weight of 295.35 g/mol. IUPAC name: 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylbutanoic acid. InChIKey: JTRDKNXNHKGMAP-UHFFFAOYSA-N.
| Molecular formula | C11H21NO6S |
|---|---|
| Molecular weight | 295.35 g/mol |
| IUPAC name | 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonylbutanoic acid |
| InChIKey | JTRDKNXNHKGMAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)S(=O)(=O)C |
Computed by PubChem (NCBI)