CAS 160141-86-6 appears in our catalog under these names: methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-methanesulfonylbutanoate, 98%, (S)-Methyl 2-((tert-butoxycarbonyl)amino)-4-(methylsulfonyl)butanoate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate (CAS 160141-86-6) is a chemical compound with the molecular formula C11H21NO6S and a molecular weight of 295.35 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate. InChIKey: XAWDOJXESCPBEB-QMMMGPOBSA-N.
| Molecular formula | C11H21NO6S |
|---|---|
| Molecular weight | 295.35 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonylbutanoate |
| InChIKey | XAWDOJXESCPBEB-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC |
Computed by PubChem (NCBI)