CAS 1439902-38-1 is the registry number for 2-[4-(4-Bromophenyl)-1-(tert-butoxycarbonyl)piperidin-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-[4-(4-bromophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid (CAS 1439902-38-1) is a chemical compound with the molecular formula C18H24BrNO4 and a molecular weight of 398.3 g/mol. IUPAC name: 2-[4-(4-bromophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid. InChIKey: IJJUJLLVKCKTSB-UHFFFAOYSA-N.
| Molecular formula | C18H24BrNO4 |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid |
| InChIKey | IJJUJLLVKCKTSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CC(=O)O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)