Products 1781329-33-6
CAS 1781329-33-6 appears in our catalog under these names: 2-(3-bromophenyl)-2-(1-tert-butoxycarbonyl-4-piperidyl)acetic acid, 95%, 2-(3-bromophenyl)-2-(1-tert-butoxycarbonyl-4-piperidyl)acetic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
2-(3-bromophenyl)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid (CAS 1781329-33-6) is a chemical compound with the molecular formula C18H24BrNO4 and a molecular weight of 398.3 g/mol. IUPAC name: 2-(3-bromophenyl)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid. InChIKey: UAROSQRISIIFJP-UHFFFAOYSA-N.
| Molecular formula | C18H24BrNO4 |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid |
| InChIKey | UAROSQRISIIFJP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)