CAS 14400-94-3 is the registry number for 2,3,4,6-Tetrabromophenol. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
2,3,4,6-tetrabromophenol (CAS 14400-94-3) is a chemical compound with the molecular formula C6H2Br4O and a molecular weight of 409.69 g/mol. IUPAC name: 2,3,4,6-tetrabromophenol. InChIKey: CXPJZISGVIVNEL-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4O |
|---|---|
| Molecular weight | 409.69 g/mol |
| IUPAC name | 2,3,4,6-tetrabromophenol |
| InChIKey | CXPJZISGVIVNEL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)O)Br |
Computed by PubChem (NCBI)